About (E)-tridec-10-en-2-ol
(E)-tridec-10-en-2-ol (PubChem CID 87079874) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is (E)-tridec-10-en-2-ol.
Molecular Properties
| Compound Name | (E)-tridec-10-en-2-ol |
| PubChem CID | 87079874 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (E)-tridec-10-en-2-ol |
| SMILES | CC/C=C/CCCCCCCC(C)O |
| InChI | InChI=1S/C13H26O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h4-5,13-14H,3,6-12H2,1-2H3/b5-4+ |
| InChIKey | UQVARQDMXOJMSY-SNAWJCMRSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-tridec-10-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-tridec-10-en-2-ol?
The IUPAC name of (E)-tridec-10-en-2-ol (CID 87079874) is (E)-tridec-10-en-2-ol.
What is the SMILES notation for (E)-tridec-10-en-2-ol?
The canonical SMILES for (E)-tridec-10-en-2-ol is CC/C=C/CCCCCCCC(C)O.
What is the InChIKey of (E)-tridec-10-en-2-ol?
The InChIKey is UQVARQDMXOJMSY-SNAWJCMRSA-N. The full InChI is InChI=1S/C13H26O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h4-5,13-14H,3,6-12H2,1-2H3/b5-4+.
What are the key properties of (E)-tridec-10-en-2-ol?
(E)-tridec-10-en-2-ol has a molecular weight of 198.35 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-tridec-10-en-2-ol is sourced from PubChem (CID 87079874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).