C13H14O5 — CID 87081717
dimethyl 3-(oxiran-2-ylmethyl)benzene-1,2-dicarboxylate (PubChem CID 87081717) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is dimethyl 3-(oxiran-2-ylmethyl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(oxiran-2-ylmethyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87081717 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | dimethyl 3-(oxiran-2-ylmethyl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(CC2CO2)c1C(=O)OC |
| InChI | InChI=1S/C13H14O5/c1-16-12(14)10-5-3-4-8(6-9-7-18-9)11(10)13(15)17-2/h3-5,9H,6-7H2,1-2H3 |
| InChIKey | XMAPULLGTRFNGG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|