About 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole
2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole (PubChem CID 8708191) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole |
| PubChem CID | 8708191 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(SCc2ccccc2)o1 |
| InChI | InChI=1S/C10H10N2OS/c1-8-11-12-10(13-8)14-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | XZCFGUMARFFMFK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole?
The IUPAC name of 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole (CID 8708191) is 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole.
What is the SMILES notation for 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole?
The canonical SMILES for 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole is Cc1nnc(SCc2ccccc2)o1.
What is the InChIKey of 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole?
The InChIKey is XZCFGUMARFFMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c1-8-11-12-10(13-8)14-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What are the key properties of 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole?
2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole has a molecular weight of 206.27 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-5-methyl-1,3,4-oxadiazole is sourced from PubChem (CID 8708191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).