C52H80NO8P — CID 87082298
[(2R)-2,3-di(docosa-2,4,6,8,10,12-hexaenoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 87082298) has the molecular formula C52H80NO8P and a molecular weight of 878.19 g/mol. Its IUPAC name is [(2R)-2,3-di(docosa-2,4,6,8,10,12-hexaenoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2,3-di(docosa-2,4,6,8,10,12-hexaenoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 87082298 |
| Molecular Formula | C52H80NO8P |
| Molecular Weight | 878.19 g/mol |
| Exact Mass | 877.56 |
| IUPAC Name | [(2R)-2,3-di(docosa-2,4,6,8,10,12-hexaenoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)C=CC=CC=CC=CC=CC=CCCCCCCCCC |
| InChI | InChI=1S/C52H80NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-44-51(54)58-48-50(49-60-62(56,57)59-47-46-53(3,4)5)61-52(55)45-43-41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h22-45,50H,6-21,46-49H2,1-5H3/t50-/m1/s1 |
| InChIKey | GQVBSOVDJKCLGM-VCZQVZGSSA-N |
| XLogP | 12.60 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.19 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|