C15H15F3N2O3 — CID 87082388
5-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]pent-4-ynamide (PubChem CID 87082388) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 5-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]pent-4-ynamide.
| Compound Name | 5-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]pent-4-ynamide |
|---|---|
| PubChem CID | 87082388 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-[3-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]pent-4-ynamide |
| SMILES | NC(=O)CCC#Cc1cccc(OCCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O3/c16-15(17,18)14(22)20-8-9-23-12-6-3-5-11(10-12)4-1-2-7-13(19)21/h3,5-6,10H,2,7-9H2,(H2,19,21)(H,20,22) |
| InChIKey | XHVPJLZFBBYGCR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|