C37H30Cl2F2N4O4 — CID 87082493
1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-naphthalen-2-ylpiperidine (PubChem CID 87082493) has the molecular formula C37H30Cl2F2N4O4 and a molecular weight of 703.57 g/mol. Its IUPAC name is 1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-naphthalen-2-ylpiperidine.
| Compound Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-naphthalen-2-ylpiperidine |
|---|---|
| PubChem CID | 87082493 |
| Molecular Formula | C37H30Cl2F2N4O4 |
| Molecular Weight | 703.57 g/mol |
| Exact Mass | 702.16 |
| IUPAC Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-naphthalen-2-ylpiperidine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cc(F)c(N3CCC(c4ccc5ccccc5c4)CC3)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C37H30Cl2F2N4O4/c38-29-9-7-26(18-35(29)44(46)47)33-11-12-34(27-8-10-30(39)36(19-27)45(48)49)43(33)28-20-31(40)37(32(41)21-28)42-15-13-23(14-16-42)25-6-5-22-3-1-2-4-24(22)17-25/h1-10,17-21,23,33-34H,11-16H2/t33-,34-/m1/s1 |
| InChIKey | AWISKICZOIOZHT-KKLWWLSJSA-N |
| XLogP | 10.71 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.57 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|