C32H27Cl2F2N5O4 — CID 87082632
2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-4-yl]pyridine (PubChem CID 87082632) has the molecular formula C32H27Cl2F2N5O4 and a molecular weight of 654.50 g/mol. Its IUPAC name is 2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-4-yl]pyridine.
| Compound Name | 2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 87082632 |
| Molecular Formula | C32H27Cl2F2N5O4 |
| Molecular Weight | 654.50 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | 2-[1-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidin-4-yl]pyridine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cc(F)c(N3CCC(c4ccccn4)CC3)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H27Cl2F2N5O4/c33-23-6-4-20(15-30(23)40(42)43)28-8-9-29(21-5-7-24(34)31(16-21)41(44)45)39(28)22-17-25(35)32(26(36)18-22)38-13-10-19(11-14-38)27-3-1-2-12-37-27/h1-7,12,15-19,28-29H,8-11,13-14H2/t28-,29-/m1/s1 |
| InChIKey | NVKVXICSIDDSLP-FQLXRVMXSA-N |
| XLogP | 8.95 |
| TPSA | 105.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.50 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|