About 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine
4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine (PubChem CID 87082818) has the molecular formula C21H15Cl2FN4O4
and a molecular weight of 477.28 g/mol. Its IUPAC name is 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine.
Molecular Properties
| Compound Name | 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine |
| PubChem CID | 87082818 |
| Molecular Formula | C21H15Cl2FN4O4 |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccnc(F)c2)ccc1Cl |
| InChI | InChI=1S/C21H15Cl2FN4O4/c22-15-3-1-12(9-19(15)27(29)30)17-5-6-18(26(17)14-7-8-25-21(24)11-14)13-2-4-16(23)20(10-13)28(31)32/h1-4,7-11,17-18H,5-6H2/t17-,18-/m1/s1 |
| InChIKey | VCQUFBPDVMJWJS-QZTJIDSGSA-N |
| XLogP | 6.43 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine?
The IUPAC name of 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine (CID 87082818) is 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine.
What is the SMILES notation for 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine?
The canonical SMILES for 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine is O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccnc(F)c2)ccc1Cl.
What is the InChIKey of 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine?
The InChIKey is VCQUFBPDVMJWJS-QZTJIDSGSA-N. The full InChI is InChI=1S/C21H15Cl2FN4O4/c22-15-3-1-12(9-19(15)27(29)30)17-5-6-18(26(17)14-7-8-25-21(24)11-14)13-2-4-16(23)20(10-13)28(31)32/h1-4,7-11,17-18H,5-6H2/t17-,18-/m1/s1.
What are the key properties of 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine?
4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine has a molecular weight of 477.28 g/mol, XLogP of 6.43, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2-fluoropyridine is sourced from PubChem (CID 87082818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).