C22H15Cl2F2N3O4 — CID 87082924
(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)-1-(3,4-difluorophenyl)pyrrolidine (PubChem CID 87082924) has the molecular formula C22H15Cl2F2N3O4 and a molecular weight of 494.28 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)-1-(3,4-difluorophenyl)pyrrolidine.
| Compound Name | (2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)-1-(3,4-difluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 87082924 |
| Molecular Formula | C22H15Cl2F2N3O4 |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | (2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)-1-(3,4-difluorophenyl)pyrrolidine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H15Cl2F2N3O4/c23-15-4-1-12(9-21(15)28(30)31)19-7-8-20(13-2-5-16(24)22(10-13)29(32)33)27(19)14-3-6-17(25)18(26)11-14/h1-6,9-11,19-20H,7-8H2/t19-,20-/m1/s1 |
| InChIKey | AUFWBJIHEQRCAQ-WOJBJXKFSA-N |
| XLogP | 7.17 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|