About methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate
methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (PubChem CID 8708294) has the molecular formula C7H10N2O3S
and a molecular weight of 202.23 g/mol. Its IUPAC name is methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| PubChem CID | 8708294 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| SMILES | CCc1nnc(SCC(=O)OC)o1 |
| InChI | InChI=1S/C7H10N2O3S/c1-3-5-8-9-7(12-5)13-4-6(10)11-2/h3-4H2,1-2H3 |
| InChIKey | DXEBNTITKIFGKX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
The IUPAC name of methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (CID 8708294) is methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
What is the SMILES notation for methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
The canonical SMILES for methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate is CCc1nnc(SCC(=O)OC)o1.
What is the InChIKey of methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
The InChIKey is DXEBNTITKIFGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3S/c1-3-5-8-9-7(12-5)13-4-6(10)11-2/h3-4H2,1-2H3.
What are the key properties of methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate?
methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate has a molecular weight of 202.23 g/mol, XLogP of 0.90, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate is sourced from PubChem (CID 8708294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).