About 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine
2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine (PubChem CID 87083040) has the molecular formula C27H20Cl2N4O4
and a molecular weight of 535.39 g/mol. Its IUPAC name is 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine.
Molecular Properties
| Compound Name | 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine |
| PubChem CID | 87083040 |
| Molecular Formula | C27H20Cl2N4O4 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(-c3ccccn3)cc2)ccc1Cl |
| InChI | InChI=1S/C27H20Cl2N4O4/c28-21-10-6-18(15-26(21)32(34)35)24-12-13-25(19-7-11-22(29)27(16-19)33(36)37)31(24)20-8-4-17(5-9-20)23-3-1-2-14-30-23/h1-11,14-16,24-25H,12-13H2/t24-,25-/m1/s1 |
| InChIKey | UPAIQYJQTOQMAL-JWQCQUIFSA-N |
| XLogP | 7.95 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine?
The IUPAC name of 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine (CID 87083040) is 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine.
What is the SMILES notation for 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine?
The canonical SMILES for 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine is O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(-c3ccccn3)cc2)ccc1Cl.
What is the InChIKey of 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine?
The InChIKey is UPAIQYJQTOQMAL-JWQCQUIFSA-N. The full InChI is InChI=1S/C27H20Cl2N4O4/c28-21-10-6-18(15-26(21)32(34)35)24-12-13-25(19-7-11-22(29)27(16-19)33(36)37)31(24)20-8-4-17(5-9-20)23-3-1-2-14-30-23/h1-11,14-16,24-25H,12-13H2/t24-,25-/m1/s1.
What are the key properties of 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine?
2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine has a molecular weight of 535.39 g/mol, XLogP of 7.95, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]phenyl]pyridine is sourced from PubChem (CID 87083040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).