About methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate
methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 87083521) has the molecular formula C21H18F2O5S2
and a molecular weight of 452.50 g/mol. Its IUPAC name is methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
Molecular Properties
| Compound Name | methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| PubChem CID | 87083521 |
| Molecular Formula | C21H18F2O5S2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | COC(=O)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18F2O5S2/c1-27-20(24)21(22,23)30(25,26)28-29(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | VMJJTAZMGFUZKQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The IUPAC name of methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (CID 87083521) is methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
What is the SMILES notation for methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The canonical SMILES for methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is COC(=O)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The InChIKey is VMJJTAZMGFUZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2O5S2/c1-27-20(24)21(22,23)30(25,26)28-29(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3.
What are the key properties of methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate has a molecular weight of 452.50 g/mol, XLogP of 5.00, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is sourced from PubChem (CID 87083521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).