C20H12O7S2 — CID 87083833
12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene-3,10-disulfonic acid (PubChem CID 87083833) has the molecular formula C20H12O7S2 and a molecular weight of 428.44 g/mol. Its IUPAC name is 12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene-3,10-disulfonic acid.
| Compound Name | 12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene-3,10-disulfonic acid |
|---|---|
| PubChem CID | 87083833 |
| Molecular Formula | C20H12O7S2 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene-3,10-disulfonic acid |
| SMILES | O=S(=O)(O)c1c2ccccc2c(S(=O)(=O)O)c2c1oc1cc3ccccc3cc12 |
| InChI | InChI=1S/C20H12O7S2/c21-28(22,23)19-13-7-3-4-8-14(13)20(29(24,25)26)18-17(19)15-9-11-5-1-2-6-12(11)10-16(15)27-18/h1-10H,(H,21,22,23)(H,24,25,26) |
| InChIKey | SPYWGWJHDCLFKF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|