C8H10Cl2N2 — CID 87083942
3,6-dichloro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]pyridazine (PubChem CID 87083942) has the molecular formula C8H10Cl2N2 and a molecular weight of 214.14 g/mol. Its IUPAC name is 3,6-dichloro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]pyridazine.
| Compound Name | 3,6-dichloro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]pyridazine |
|---|---|
| PubChem CID | 87083942 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3,6-dichloro-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]pyridazine |
| SMILES | [2H]C([2H])([2H])C(c1cc(Cl)nnc1Cl)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H10Cl2N2/c1-8(2,3)5-4-6(9)11-12-7(5)10/h4H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | DTUZXHRABOWYAE-GQALSZNTSA-N |
| XLogP | 3.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |