About 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate
2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate (PubChem CID 87083986) has the molecular formula C13H29O8P
and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate |
| PubChem CID | 87083986 |
| Molecular Formula | C13H29O8P |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate |
| SMILES | CC(C)(C)COCCOCCOCCOCCOP(=O)(O)O |
| InChI | InChI=1S/C13H29O8P/c1-13(2,3)12-20-9-8-18-5-4-17-6-7-19-10-11-21-22(14,15)16/h4-12H2,1-3H3,(H2,14,15,16) |
| InChIKey | NTSPCCAYZOHMFZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate?
The IUPAC name of 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate (CID 87083986) is 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate.
What is the SMILES notation for 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate?
The canonical SMILES for 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate is CC(C)(C)COCCOCCOCCOCCOP(=O)(O)O.
What is the InChIKey of 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate?
The InChIKey is NTSPCCAYZOHMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29O8P/c1-13(2,3)12-20-9-8-18-5-4-17-6-7-19-10-11-21-22(14,15)16/h4-12H2,1-3H3,(H2,14,15,16).
What are the key properties of 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate?
2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate has a molecular weight of 344.34 g/mol, XLogP of 1.21, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate is sourced from PubChem (CID 87083986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).