C7H6F8 — CID 87084201
1,1,3,4,5,6,7,7-octafluorohept-1-ene (PubChem CID 87084201) has the molecular formula C7H6F8 and a molecular weight of 242.11 g/mol. Its IUPAC name is 1,1,3,4,5,6,7,7-octafluorohept-1-ene.
| Compound Name | 1,1,3,4,5,6,7,7-octafluorohept-1-ene |
|---|---|
| PubChem CID | 87084201 |
| Molecular Formula | C7H6F8 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1,1,3,4,5,6,7,7-octafluorohept-1-ene |
| SMILES | FC(F)=CC(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C7H6F8/c8-2(1-3(9)10)4(11)5(12)6(13)7(14)15/h1-2,4-7H |
| InChIKey | BUKMGLQFNFNHQU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |