C14H14N2O6S2 — CID 87084390
3-imino-6-[2-(4-imino-6-sulfocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 87084390) has the molecular formula C14H14N2O6S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-imino-6-[2-(4-imino-6-sulfocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 3-imino-6-[2-(4-imino-6-sulfocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 87084390 |
| Molecular Formula | C14H14N2O6S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-imino-6-[2-(4-imino-6-sulfocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | [H]/N=C1/C=C(S(=O)(=O)O)C(C=CC2=CC/C(=N\[H])C=C2S(=O)(=O)O)=CC1 |
| InChI | InChI=1S/C14H14N2O6S2/c15-11-5-3-9(13(7-11)23(17,18)19)1-2-10-4-6-12(16)8-14(10)24(20,21)22/h1-4,7-8,15-16H,5-6H2,(H,17,18,19)(H,20,21,22)/b2-1?,15-11+,16-12+ |
| InChIKey | GKKNEKVULOHQIB-SXNNLGMUSA-N |
| XLogP | 1.79 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|