C24H28N4O3 — CID 87085101
2-[4-(methylperoxymethyl)phenyl]-N-(2-pyridin-4-ylethyl)-2-(2-pyridin-3-ylethylamino)acetamide (PubChem CID 87085101) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[4-(methylperoxymethyl)phenyl]-N-(2-pyridin-4-ylethyl)-2-(2-pyridin-3-ylethylamino)acetamide.
| Compound Name | 2-[4-(methylperoxymethyl)phenyl]-N-(2-pyridin-4-ylethyl)-2-(2-pyridin-3-ylethylamino)acetamide |
|---|---|
| PubChem CID | 87085101 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-[4-(methylperoxymethyl)phenyl]-N-(2-pyridin-4-ylethyl)-2-(2-pyridin-3-ylethylamino)acetamide |
| SMILES | COOCc1ccc(C(NCCc2cccnc2)C(=O)NCCc2ccncc2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-30-31-18-21-4-6-22(7-5-21)23(27-15-11-20-3-2-12-26-17-20)24(29)28-16-10-19-8-13-25-14-9-19/h2-9,12-14,17,23,27H,10-11,15-16,18H2,1H3,(H,28,29) |
| InChIKey | VCLHNBWDHJUWRC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|