C13H19F — CID 87085248
1-[(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-1-methylcyclobutane (PubChem CID 87085248) has the molecular formula C13H19F and a molecular weight of 194.29 g/mol. Its IUPAC name is 1-[(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-1-methylcyclobutane.
| Compound Name | 1-[(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-1-methylcyclobutane |
|---|---|
| PubChem CID | 87085248 |
| Molecular Formula | C13H19F |
| Molecular Weight | 194.29 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-[(2Z,4E,6E)-7-fluoroocta-2,4,6-trien-4-yl]-1-methylcyclobutane |
| SMILES | C/C=C\C(=C/C=C(\C)F)C1(C)CCC1 |
| InChI | InChI=1S/C13H19F/c1-4-6-12(8-7-11(2)14)13(3)9-5-10-13/h4,6-8H,5,9-10H2,1-3H3/b6-4-,11-7+,12-8+ |
| InChIKey | CDARZZANUBPZTI-ABPJNWLSSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|