C8H8Cl2N4 — CID 87085630
7-chloro-2-(chloromethyl)-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 87085630) has the molecular formula C8H8Cl2N4 and a molecular weight of 231.09 g/mol. Its IUPAC name is 7-chloro-2-(chloromethyl)-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 7-chloro-2-(chloromethyl)-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 87085630 |
| Molecular Formula | C8H8Cl2N4 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 7-chloro-2-(chloromethyl)-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | Cc1c(Cl)nc(C)n2nc(CCl)nc12 |
| InChI | InChI=1S/C8H8Cl2N4/c1-4-7(10)11-5(2)14-8(4)12-6(3-9)13-14/h3H2,1-2H3 |
| InChIKey | ZXWKRJVNEBWFAC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|