C22H21FN4O4S — CID 87085789
3-[[(3Z)-6-fluoro-3-[[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 87085789) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-[[(3Z)-6-fluoro-3-[[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[(3Z)-6-fluoro-3-[[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87085789 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3-[[(3Z)-6-fluoro-3-[[4-(morpholin-4-ylmethyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1Nc2cc(F)c(CN3C(=O)CSC3=O)cc2/C1=C/c1cc(CN2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C22H21FN4O4S/c23-18-8-19-16(6-14(18)11-27-20(28)12-32-22(27)30)17(21(29)25-19)7-15-5-13(9-24-15)10-26-1-3-31-4-2-26/h5-9,24H,1-4,10-12H2,(H,25,29)/b17-7- |
| InChIKey | KSBUDNPUULWUQO-IDUWFGFVSA-N |
| XLogP | 2.67 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|