C21H33NO — CID 87085823
(E)-1-[(1S,4aS,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine (PubChem CID 87085823) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (E)-1-[(1S,4aS,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine.
| Compound Name | (E)-1-[(1S,4aS,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 87085823 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (E)-1-[(1S,4aS,7R)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine |
| SMILES | C=C[C@]1(C)CC=C2C(CCC3[C@@](C)(/C=N/OC)CCC[C@]23C)C1 |
| InChI | InChI=1S/C21H33NO/c1-6-19(2)13-10-17-16(14-19)8-9-18-20(3,15-22-23-5)11-7-12-21(17,18)4/h6,10,15-16,18H,1,7-9,11-14H2,2-5H3/b22-15+/t16?,18?,19-,20-,21-/m1/s1 |
| InChIKey | XVWDBAVVTWZDOX-KDHLCRFQSA-N |
| XLogP | 5.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|