About [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea
[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea (PubChem CID 87086671) has the molecular formula C8H18N4O3S
and a molecular weight of 250.32 g/mol. Its IUPAC name is [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea.
Molecular Properties
| Compound Name | [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea |
| PubChem CID | 87086671 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea |
| SMILES | CNC(=O)O/N=C/C(C)(C)SC.NC(N)=O |
| InChI | InChI=1S/C7H14N2O2S.CH4N2O/c1-7(2,12-4)5-9-11-6(10)8-3;2-1(3)4/h5H,1-4H3,(H,8,10);(H4,2,3,4)/b9-5+; |
| InChIKey | DHZOXHHXAOBRSX-SZKNIZGXSA-N |
| XLogP | 0.49 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea?
The IUPAC name of [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea (CID 87086671) is [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea.
What is the SMILES notation for [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea?
The canonical SMILES for [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea is CNC(=O)O/N=C/C(C)(C)SC.NC(N)=O.
What is the InChIKey of [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea?
The InChIKey is DHZOXHHXAOBRSX-SZKNIZGXSA-N. The full InChI is InChI=1S/C7H14N2O2S.CH4N2O/c1-7(2,12-4)5-9-11-6(10)8-3;2-1(3)4/h5H,1-4H3,(H,8,10);(H4,2,3,4)/b9-5+;.
What are the key properties of [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea?
[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea has a molecular weight of 250.32 g/mol, XLogP of 0.49, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate;urea is sourced from PubChem (CID 87086671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).