C24H17F7N8O — CID 87086915
1-[4-[4-amino-6-cyano-7-[(2,2,2-trifluoroethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 87086915) has the molecular formula C24H17F7N8O and a molecular weight of 566.44 g/mol. Its IUPAC name is 1-[4-[4-amino-6-cyano-7-[(2,2,2-trifluoroethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-6-cyano-7-[(2,2,2-trifluoroethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87086915 |
| Molecular Formula | C24H17F7N8O |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 1-[4-[4-amino-6-cyano-7-[(2,2,2-trifluoroethylamino)methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1c(-c2ccc(NC(=O)Nc3cc(C(F)(F)F)ccc3F)cc2)c2c(N)ncnn2c1CNCC(F)(F)F |
| InChI | InChI=1S/C24H17F7N8O/c25-16-6-3-13(24(29,30)31)7-17(16)38-22(40)37-14-4-1-12(2-5-14)19-15(8-32)18(9-34-10-23(26,27)28)39-20(19)21(33)35-11-36-39/h1-7,11,34H,9-10H2,(H2,33,35,36)(H2,37,38,40) |
| InChIKey | FJMUAXHPQPMSHS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |