About 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine
3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine (PubChem CID 87087007) has the molecular formula C18H39N
and a molecular weight of 269.52 g/mol. Its IUPAC name is 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine |
| PubChem CID | 87087007 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine |
| SMILES | CCC(CC)(NC(CC)(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H39N/c1-11-17(12-2,15(5,6)7)19-18(13-3,14-4)16(8,9)10/h19H,11-14H2,1-10H3 |
| InChIKey | RCIWPECYQQIQTF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine?
The IUPAC name of 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine (CID 87087007) is 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine.
What is the SMILES notation for 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine?
The canonical SMILES for 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine is CCC(CC)(NC(CC)(CC)C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine?
The InChIKey is RCIWPECYQQIQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N/c1-11-17(12-2,15(5,6)7)19-18(13-3,14-4)16(8,9)10/h19H,11-14H2,1-10H3.
What are the key properties of 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine?
3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine has a molecular weight of 269.52 g/mol, XLogP of 5.79, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-(3-ethyl-2,2-dimethylpentan-3-yl)-2,2-dimethylpentan-3-amine is sourced from PubChem (CID 87087007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).