About 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate
2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87087057) has the molecular formula C14H20O6
and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| PubChem CID | 87087057 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C(CCC1CO1)C(=O)O |
| InChI | InChI=1S/2C7H10O3/c1-5(2)7(8)10-4-6-3-9-6;1-5(7(8)9)2-3-6-4-10-6/h6H,1,3-4H2,2H3;6H,1-4H2,(H,8,9) |
| InChIKey | GFUJVLIBXFKPCO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The IUPAC name of 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate (CID 87087057) is 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC1CO1.C=C(CCC1CO1)C(=O)O.
What is the InChIKey of 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The InChIKey is GFUJVLIBXFKPCO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H10O3/c1-5(2)7(8)10-4-6-3-9-6;1-5(7(8)9)2-3-6-4-10-6/h6H,1,3-4H2,2H3;6H,1-4H2,(H,8,9).
What are the key properties of 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate?
2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate has a molecular weight of 284.31 g/mol, XLogP of 1.31, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4-(oxiran-2-yl)butanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 87087057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).