C10H16N2O4 — CID 87087134
(2E,6E)-N,N'-dihydroxy-2,7-dimethylocta-2,6-dienediamide (PubChem CID 87087134) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2E,6E)-N,N'-dihydroxy-2,7-dimethylocta-2,6-dienediamide.
| Compound Name | (2E,6E)-N,N'-dihydroxy-2,7-dimethylocta-2,6-dienediamide |
|---|---|
| PubChem CID | 87087134 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2E,6E)-N,N'-dihydroxy-2,7-dimethylocta-2,6-dienediamide |
| SMILES | C/C(=C\CC/C=C(\C)C(=O)NO)C(=O)NO |
| InChI | InChI=1S/C10H16N2O4/c1-7(9(13)11-15)5-3-4-6-8(2)10(14)12-16/h5-6,15-16H,3-4H2,1-2H3,(H,11,13)(H,12,14)/b7-5+,8-6+ |
| InChIKey | ZRSLHESYJSLIBS-KQQUZDAGSA-N |
| XLogP | 0.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|