C14H16O7S — CID 87087135
3,4-bis(prop-2-enyl)-4-sulfocyclohexa-2,5-diene-1,2-dicarboxylic acid (PubChem CID 87087135) has the molecular formula C14H16O7S and a molecular weight of 328.34 g/mol. Its IUPAC name is 3,4-bis(prop-2-enyl)-4-sulfocyclohexa-2,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4-bis(prop-2-enyl)-4-sulfocyclohexa-2,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 87087135 |
| Molecular Formula | C14H16O7S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3,4-bis(prop-2-enyl)-4-sulfocyclohexa-2,5-diene-1,2-dicarboxylic acid |
| SMILES | C=CCC1=C(C(=O)O)C(C(=O)O)C=CC1(CC=C)S(=O)(=O)O |
| InChI | InChI=1S/C14H16O7S/c1-3-5-10-11(13(17)18)9(12(15)16)6-8-14(10,7-4-2)22(19,20)21/h3-4,6,8-9H,1-2,5,7H2,(H,15,16)(H,17,18)(H,19,20,21) |
| InChIKey | SYZUGUAQIHSBKK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|