C12H12N2 — CID 87087142
1,2,3,4-tetrahydroazepino[4,5-b]indole (PubChem CID 87087142) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroazepino[4,5-b]indole.
| Compound Name | 1,2,3,4-tetrahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 87087142 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,2,3,4-tetrahydroazepino[4,5-b]indole |
| SMILES | C1=C2N=c3ccccc3=C2CCNC1 |
| InChI | InChI=1S/C12H12N2/c1-2-4-11-9(3-1)10-5-7-13-8-6-12(10)14-11/h1-4,6,13H,5,7-8H2 |
| InChIKey | XLBFVLCMNQHPRB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |