C19H30INO — CID 87087242
(E)-1-[(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine (PubChem CID 87087242) has the molecular formula C19H30INO and a molecular weight of 415.36 g/mol. Its IUPAC name is (E)-1-[(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine.
| Compound Name | (E)-1-[(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 87087242 |
| Molecular Formula | C19H30INO |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (E)-1-[(1R,4aR,7S)-7-iodo-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]-N-methoxymethanimine |
| SMILES | CO/N=C/[C@]1(C)CCC[C@@]2(C)C3=CC[C@](C)(I)CC3CCC21 |
| InChI | InChI=1S/C19H30INO/c1-17(13-21-22-4)9-5-10-19(3)15-8-11-18(2,20)12-14(15)6-7-16(17)19/h8,13-14,16H,5-7,9-12H2,1-4H3/b21-13+/t14?,16?,17-,18-,19-/m0/s1 |
| InChIKey | JHLQKWXNLYXLAC-QKVDVZMRSA-N |
| XLogP | 5.76 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|