About (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol
(1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol (PubChem CID 87087339) has the molecular formula C10H10F6O
and a molecular weight of 260.18 g/mol. Its IUPAC name is (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol |
| PubChem CID | 87087339 |
| Molecular Formula | C10H10F6O |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol |
| SMILES | C[C@@H](O)C1=CC(C(F)(F)F)CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C10H10F6O/c1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-3,5,7,17H,4H2,1H3/t5-,7?/m1/s1 |
| InChIKey | XFOPMCXEGQITSK-FOUAAFFMSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol?
The IUPAC name of (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol (CID 87087339) is (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol.
What is the SMILES notation for (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol?
The canonical SMILES for (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol is C[C@@H](O)C1=CC(C(F)(F)F)CC(C(F)(F)F)=C1.
What is the InChIKey of (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol?
The InChIKey is XFOPMCXEGQITSK-FOUAAFFMSA-N. The full InChI is InChI=1S/C10H10F6O/c1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-3,5,7,17H,4H2,1H3/t5-,7?/m1/s1.
What are the key properties of (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol?
(1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol has a molecular weight of 260.18 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[3,5-bis(trifluoromethyl)cyclohexa-1,5-dien-1-yl]ethanol is sourced from PubChem (CID 87087339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).