C24H16ClNO5 — CID 87087377
4-[(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)methyl]benzoyl chloride (PubChem CID 87087377) has the molecular formula C24H16ClNO5 and a molecular weight of 433.85 g/mol. Its IUPAC name is 4-[(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)methyl]benzoyl chloride.
| Compound Name | 4-[(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)methyl]benzoyl chloride |
|---|---|
| PubChem CID | 87087377 |
| Molecular Formula | C24H16ClNO5 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 4-[(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)methyl]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(CN2C(=O)C3(COc4cc5c(cc43)OCO5)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H16ClNO5/c25-22(27)15-7-5-14(6-8-15)11-26-18-4-2-1-3-16(18)24(23(26)28)12-29-19-10-21-20(9-17(19)24)30-13-31-21/h1-10H,11-13H2 |
| InChIKey | YUKKMJGVOYCCIO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|