C36H38N2O6 — CID 87087651
9,10-bis(hexylcarbamoyl)perylene-3,4-dicarboxylic acid (PubChem CID 87087651) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is 9,10-bis(hexylcarbamoyl)perylene-3,4-dicarboxylic acid.
| Compound Name | 9,10-bis(hexylcarbamoyl)perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 87087651 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 9,10-bis(hexylcarbamoyl)perylene-3,4-dicarboxylic acid |
| SMILES | CCCCCCNC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(=O)NCCCCCC)c1c25)c43 |
| InChI | InChI=1S/C36H38N2O6/c1-3-5-7-9-19-37-33(39)25-15-11-21-23-13-17-27(35(41)42)32-28(36(43)44)18-14-24(30(23)32)22-12-16-26(31(25)29(21)22)34(40)38-20-10-8-6-4-2/h11-18H,3-10,19-20H2,1-2H3,(H,37,39)(H,38,40)(H,41,42)(H,43,44) |
| InChIKey | RGEOJBAJNJQRPF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|