C20H30O12 — CID 87087675
4,5-diacetyloxy-4-(2-carboxyethyl)-5-(3-carboxypropyl)nonanedioic acid (PubChem CID 87087675) has the molecular formula C20H30O12 and a molecular weight of 462.45 g/mol. Its IUPAC name is 4,5-diacetyloxy-4-(2-carboxyethyl)-5-(3-carboxypropyl)nonanedioic acid.
| Compound Name | 4,5-diacetyloxy-4-(2-carboxyethyl)-5-(3-carboxypropyl)nonanedioic acid |
|---|---|
| PubChem CID | 87087675 |
| Molecular Formula | C20H30O12 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4,5-diacetyloxy-4-(2-carboxyethyl)-5-(3-carboxypropyl)nonanedioic acid |
| SMILES | CC(=O)OC(CCCC(=O)O)(CCCC(=O)O)C(CCC(=O)O)(CCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C20H30O12/c1-13(21)31-19(9-3-5-15(23)24,10-4-6-16(25)26)20(32-14(2)22,11-7-17(27)28)12-8-18(29)30/h3-12H2,1-2H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | CZYGUMDMNFFNGR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |