C23H25ClN4O3 — CID 87087920
2-(1,3-benzodioxol-5-yl)-N-[[3-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazol-5-yl]methyl]propanamide (PubChem CID 87087920) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[[3-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazol-5-yl]methyl]propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[[3-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazol-5-yl]methyl]propanamide |
|---|---|
| PubChem CID | 87087920 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[[3-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazol-5-yl]methyl]propanamide |
| SMILES | CC(C(=O)NCc1cc(C(C)(C)C)nn1-c1cccc(Cl)n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H25ClN4O3/c1-14(15-8-9-17-18(10-15)31-13-30-17)22(29)25-12-16-11-19(23(2,3)4)27-28(16)21-7-5-6-20(24)26-21/h5-11,14H,12-13H2,1-4H3,(H,25,29) |
| InChIKey | PAUQGTCIXXKNBE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|