About 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate
3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate (PubChem CID 87087939) has the molecular formula C21H37NO4
and a molecular weight of 367.53 g/mol. Its IUPAC name is 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate.
Molecular Properties
| Compound Name | 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate |
| PubChem CID | 87087939 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCCC=CC=CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C21H37NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-21(25)26-19(17-20(23)24)18-22(2,3)4/h13-16,19H,5-12,17-18H2,1-4H3 |
| InChIKey | DBJDCEJXEMUHGM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate?
The IUPAC name of 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate (CID 87087939) is 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate.
What is the SMILES notation for 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate?
The canonical SMILES for 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate is CCCCCCCCCC=CC=CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.
What is the InChIKey of 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate?
The InChIKey is DBJDCEJXEMUHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-21(25)26-19(17-20(23)24)18-22(2,3)4/h13-16,19H,5-12,17-18H2,1-4H3.
What are the key properties of 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate?
3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate has a molecular weight of 367.53 g/mol, XLogP of 3.00, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tetradeca-2,4-dienoyloxy-4-(trimethylazaniumyl)butanoate is sourced from PubChem (CID 87087939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).