About 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid
5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid (PubChem CID 87088681) has the molecular formula C12H16O6
and a molecular weight of 256.25 g/mol. Its IUPAC name is 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid |
| PubChem CID | 87088681 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=CC1(CCC=CC(=O)O)CO1 |
| InChI | InChI=1S/C8H10O4.C4H6O2/c9-5-8(6-12-8)4-2-1-3-7(10)11;1-3(2)4(5)6/h1,3,5H,2,4,6H2,(H,10,11);1H2,2H3,(H,5,6) |
| InChIKey | DMHXFTGERNVELK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid?
The IUPAC name of 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid (CID 87088681) is 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid.
What is the SMILES notation for 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid?
The canonical SMILES for 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid is C=C(C)C(=O)O.O=CC1(CCC=CC(=O)O)CO1.
What is the InChIKey of 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid?
The InChIKey is DMHXFTGERNVELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C4H6O2/c9-5-8(6-12-8)4-2-1-3-7(10)11;1-3(2)4(5)6/h1,3,5H,2,4,6H2,(H,10,11);1H2,2H3,(H,5,6).
What are the key properties of 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid?
5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid has a molecular weight of 256.25 g/mol, XLogP of 1.02, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-formyloxiran-2-yl)pent-2-enoic acid;2-methylprop-2-enoic acid is sourced from PubChem (CID 87088681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).