About bis(dihydroxy(oxo)phosphanium);ethenol
bis(dihydroxy(oxo)phosphanium);ethenol (PubChem CID 87088723) has the molecular formula C2H8O7P2+2
and a molecular weight of 206.03 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);ethenol.
Molecular Properties
| Compound Name | bis(dihydroxy(oxo)phosphanium);ethenol |
|---|
| PubChem CID | 87088723 |
|---|
| Molecular Formula | C2H8O7P2+2 |
|---|
| Molecular Weight | 206.03 g/mol |
|---|
| Exact Mass | 205.97 |
|---|
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);ethenol |
|---|
| SMILES | C=CO.O=[P+](O)O.O=[P+](O)O |
|---|
| InChI | InChI=1S/C2H4O.2HO3P/c1-2-3;2*1-4(2)3/h2-3H,1H2;2*(H-,1,2,3)/p+2 |
|---|
| InChIKey | YXYYHHKEBZUOBA-UHFFFAOYSA-P |
|---|
| XLogP | -0.06 |
|---|
| TPSA | 135.29 Ų |
|---|
| H-Bond Donors | 5 |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxy(oxo)phosphanium);ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);ethenol?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);ethenol (CID 87088723) is bis(dihydroxy(oxo)phosphanium);ethenol.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);ethenol?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);ethenol is C=CO.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);ethenol?
The InChIKey is YXYYHHKEBZUOBA-UHFFFAOYSA-P. The full InChI is InChI=1S/C2H4O.2HO3P/c1-2-3;2*1-4(2)3/h2-3H,1H2;2*(H-,1,2,3)/p+2.
What are the key properties of bis(dihydroxy(oxo)phosphanium);ethenol?
bis(dihydroxy(oxo)phosphanium);ethenol has a molecular weight of 206.03 g/mol, XLogP of -0.06, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);ethenol is sourced from PubChem (CID 87088723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).