About sulfuric acid;2,4,4-trimethylpentan-2-amine
sulfuric acid;2,4,4-trimethylpentan-2-amine (PubChem CID 87088849) has the molecular formula C8H21NO4S
and a molecular weight of 227.33 g/mol. Its IUPAC name is sulfuric acid;2,4,4-trimethylpentan-2-amine.
Molecular Properties
| Compound Name | sulfuric acid;2,4,4-trimethylpentan-2-amine |
| PubChem CID | 87088849 |
| Molecular Formula | C8H21NO4S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | sulfuric acid;2,4,4-trimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)N.O=S(=O)(O)O |
| InChI | InChI=1S/C8H19N.H2O4S/c1-7(2,3)6-8(4,5)9;1-5(2,3)4/h6,9H2,1-5H3;(H2,1,2,3,4) |
| InChIKey | UBXMYQDGMQPIOM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;2,4,4-trimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;2,4,4-trimethylpentan-2-amine?
The IUPAC name of sulfuric acid;2,4,4-trimethylpentan-2-amine (CID 87088849) is sulfuric acid;2,4,4-trimethylpentan-2-amine.
What is the SMILES notation for sulfuric acid;2,4,4-trimethylpentan-2-amine?
The canonical SMILES for sulfuric acid;2,4,4-trimethylpentan-2-amine is CC(C)(C)CC(C)(C)N.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;2,4,4-trimethylpentan-2-amine?
The InChIKey is UBXMYQDGMQPIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.H2O4S/c1-7(2,3)6-8(4,5)9;1-5(2,3)4/h6,9H2,1-5H3;(H2,1,2,3,4).
What are the key properties of sulfuric acid;2,4,4-trimethylpentan-2-amine?
sulfuric acid;2,4,4-trimethylpentan-2-amine has a molecular weight of 227.33 g/mol, XLogP of 1.51, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;2,4,4-trimethylpentan-2-amine is sourced from PubChem (CID 87088849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).