C21H20F9NO2 — CID 87088870
6-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-methoxycyclohexa-2,4-diene-1-carboxamide (PubChem CID 87088870) has the molecular formula C21H20F9NO2 and a molecular weight of 489.38 g/mol. Its IUPAC name is 6-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-methoxycyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-methoxycyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 87088870 |
| Molecular Formula | C21H20F9NO2 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 6-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-methoxycyclohexa-2,4-diene-1-carboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(C)c1C1(OC)C=CC=CC1C(N)=O |
| InChI | InChI=1S/C21H20F9NO2/c1-4-12-10-13(18(22,20(25,26)27)19(23,24)21(28,29)30)9-11(2)15(12)17(33-3)8-6-5-7-14(17)16(31)32/h5-10,14H,4H2,1-3H3,(H2,31,32) |
| InChIKey | RPUQPRPYBQEMKY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|