About tributyl(octyl)azanium;trifluoromethanesulfonate
tributyl(octyl)azanium;trifluoromethanesulfonate (PubChem CID 87089406) has the molecular formula C21H44F3NO3S
and a molecular weight of 447.65 g/mol. Its IUPAC name is tributyl(octyl)azanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | tributyl(octyl)azanium;trifluoromethanesulfonate |
| PubChem CID | 87089406 |
| Molecular Formula | C21H44F3NO3S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | tributyl(octyl)azanium;trifluoromethanesulfonate |
| SMILES | CCCCCCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H44N.CHF3O3S/c1-5-9-13-14-15-16-20-21(17-10-6-2,18-11-7-3)19-12-8-4;2-1(3,4)8(5,6)7/h5-20H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YWRSPDSZBLLBPN-UHFFFAOYSA-M |
| XLogP | 6.62 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tributyl(octyl)azanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(octyl)azanium;trifluoromethanesulfonate?
The IUPAC name of tributyl(octyl)azanium;trifluoromethanesulfonate (CID 87089406) is tributyl(octyl)azanium;trifluoromethanesulfonate.
What is the SMILES notation for tributyl(octyl)azanium;trifluoromethanesulfonate?
The canonical SMILES for tributyl(octyl)azanium;trifluoromethanesulfonate is CCCCCCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of tributyl(octyl)azanium;trifluoromethanesulfonate?
The InChIKey is YWRSPDSZBLLBPN-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H44N.CHF3O3S/c1-5-9-13-14-15-16-20-21(17-10-6-2,18-11-7-3)19-12-8-4;2-1(3,4)8(5,6)7/h5-20H2,1-4H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of tributyl(octyl)azanium;trifluoromethanesulfonate?
tributyl(octyl)azanium;trifluoromethanesulfonate has a molecular weight of 447.65 g/mol, XLogP of 6.62, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(octyl)azanium;trifluoromethanesulfonate is sourced from PubChem (CID 87089406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).