C22H44F6N2O4S2 — CID 87089410
5,6-dibutyldodecan-5-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 87089410) has the molecular formula C22H44F6N2O4S2 and a molecular weight of 578.73 g/mol. Its IUPAC name is 5,6-dibutyldodecan-5-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 5,6-dibutyldodecan-5-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 87089410 |
| Molecular Formula | C22H44F6N2O4S2 |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 5,6-dibutyldodecan-5-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCCCC(CCCC)C(N)(CCCC)CCCC.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H43N.C2HF6NO4S2/c1-5-9-13-14-16-19(15-10-6-2)20(21,17-11-7-3)18-12-8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h19H,5-18,21H2,1-4H3;9H |
| InChIKey | PKPPOCLZPVKDML-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|