C13H26F6N2O4S2 — CID 87089412
2,3-dimethylnonan-2-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 87089412) has the molecular formula C13H26F6N2O4S2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 2,3-dimethylnonan-2-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 2,3-dimethylnonan-2-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 87089412 |
| Molecular Formula | C13H26F6N2O4S2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2,3-dimethylnonan-2-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCCCC(C)C(C)(C)N.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H25N.C2HF6NO4S2/c1-5-6-7-8-9-10(2)11(3,4)12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h10H,5-9,12H2,1-4H3;9H |
| InChIKey | FHXMBRZAIGOCSR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|