C12H20O6 — CID 87089825
2-[(E)-but-2-enoyl]oxyethyl (E)-but-2-enoate;ethane-1,2-diol (PubChem CID 87089825) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[(E)-but-2-enoyl]oxyethyl (E)-but-2-enoate;ethane-1,2-diol.
| Compound Name | 2-[(E)-but-2-enoyl]oxyethyl (E)-but-2-enoate;ethane-1,2-diol |
|---|---|
| PubChem CID | 87089825 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-[(E)-but-2-enoyl]oxyethyl (E)-but-2-enoate;ethane-1,2-diol |
| SMILES | C/C=C/C(=O)OCCOC(=O)/C=C/C.OCCO |
| InChI | InChI=1S/C10H14O4.C2H6O2/c1-3-5-9(11)13-7-8-14-10(12)6-4-2;3-1-2-4/h3-6H,7-8H2,1-2H3;3-4H,1-2H2/b5-3+,6-4+; |
| InChIKey | SFUFRSSUBKDYMS-WEUBHIEESA-N |
| XLogP | 0.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|