C23H25F3N4O4S — CID 87090275
[3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]-N-methylsulfonylanilino] 2,2,2-trifluoroacetate (PubChem CID 87090275) has the molecular formula C23H25F3N4O4S and a molecular weight of 510.54 g/mol. Its IUPAC name is [3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]-N-methylsulfonylanilino] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]-N-methylsulfonylanilino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87090275 |
| Molecular Formula | C23H25F3N4O4S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]-N-methylsulfonylanilino] 2,2,2-trifluoroacetate |
| SMILES | CS(=O)(=O)N(OC(=O)C(F)(F)F)c1cccc(CN(c2ccc3[nH]ccc3c2)C2CCNCC2)c1 |
| InChI | InChI=1S/C23H25F3N4O4S/c1-35(32,33)30(34-22(31)23(24,25)26)20-4-2-3-16(13-20)15-29(18-8-10-27-11-9-18)19-5-6-21-17(14-19)7-12-28-21/h2-7,12-14,18,27-28H,8-11,15H2,1H3 |
| InChIKey | SMQZFXKHTRZFAG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|