C14H28O8 — CID 87090353
[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] octanoate (PubChem CID 87090353) has the molecular formula C14H28O8 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] octanoate.
| Compound Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] octanoate |
|---|---|
| PubChem CID | 87090353 |
| Molecular Formula | C14H28O8 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] octanoate |
| SMILES | CCCCCCCC(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H28O8/c1-2-3-4-5-6-7-10(17)22-14(21)13(20)12(19)11(18)9(16)8-15/h9,11-16,18-21H,2-8H2,1H3/t9-,11-,12+,13-,14?/m1/s1 |
| InChIKey | DRDLXVUYNXNFPO-GQYPCLOQSA-N |
| XLogP | -1.36 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|