C13H8Cl7NO — CID 87090411
1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;1,3-oxazole (PubChem CID 87090411) has the molecular formula C13H8Cl7NO and a molecular weight of 442.38 g/mol. Its IUPAC name is 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;1,3-oxazole.
| Compound Name | 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;1,3-oxazole |
|---|---|
| PubChem CID | 87090411 |
| Molecular Formula | C13H8Cl7NO |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 438.84 |
| IUPAC Name | 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;1,3-oxazole |
| SMILES | ClC1=C(Cl)C2(Cl)C3C(Cl)C=CC3C1(Cl)C2(Cl)Cl.c1cocn1 |
| InChI | InChI=1S/C10H5Cl7.C3H3NO/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17;1-2-5-3-4-1/h1-5H;1-3H |
| InChIKey | PENSJUYPTQRLNW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|