C5H10O4S — CID 87090529
(2R,3R,4S)-2,3,4-trihydroxy-5-sulfanylpentanal (PubChem CID 87090529) has the molecular formula C5H10O4S and a molecular weight of 166.20 g/mol. Its IUPAC name is (2R,3R,4S)-2,3,4-trihydroxy-5-sulfanylpentanal.
| Compound Name | (2R,3R,4S)-2,3,4-trihydroxy-5-sulfanylpentanal |
|---|---|
| PubChem CID | 87090529 |
| Molecular Formula | C5H10O4S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | (2R,3R,4S)-2,3,4-trihydroxy-5-sulfanylpentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)CS |
| InChI | InChI=1S/C5H10O4S/c6-1-3(7)5(9)4(8)2-10/h1,3-5,7-10H,2H2/t3-,4+,5+/m0/s1 |
| InChIKey | VKIZGCILTVKEFV-VPENINKCSA-N |
| XLogP | -1.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|