About 10aH-tetrazolo[1,5-a][1]benzazepine
10aH-tetrazolo[1,5-a][1]benzazepine (PubChem CID 87090547) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 10aH-tetrazolo[1,5-a][1]benzazepine.
Molecular Properties
| Compound Name | 10aH-tetrazolo[1,5-a][1]benzazepine |
| PubChem CID | 87090547 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 10aH-tetrazolo[1,5-a][1]benzazepine |
| SMILES | C1=CC2=CC=Cc3nnnn3C2C=C1 |
| InChI | InChI=1S/C10H8N4/c1-2-6-9-8(4-1)5-3-7-10-11-12-13-14(9)10/h1-7,9H |
| InChIKey | ITQXDCDNOINMOB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10aH-tetrazolo[1,5-a][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-tetrazolo[1,5-a][1]benzazepine?
The IUPAC name of 10aH-tetrazolo[1,5-a][1]benzazepine (CID 87090547) is 10aH-tetrazolo[1,5-a][1]benzazepine.
What is the SMILES notation for 10aH-tetrazolo[1,5-a][1]benzazepine?
The canonical SMILES for 10aH-tetrazolo[1,5-a][1]benzazepine is C1=CC2=CC=Cc3nnnn3C2C=C1.
What is the InChIKey of 10aH-tetrazolo[1,5-a][1]benzazepine?
The InChIKey is ITQXDCDNOINMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c1-2-6-9-8(4-1)5-3-7-10-11-12-13-14(9)10/h1-7,9H.
What are the key properties of 10aH-tetrazolo[1,5-a][1]benzazepine?
10aH-tetrazolo[1,5-a][1]benzazepine has a molecular weight of 184.20 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-tetrazolo[1,5-a][1]benzazepine is sourced from PubChem (CID 87090547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).