C15H15ClN2O4S — CID 87090565
(2R,3R,4S,5S)-2-[[6-(2-chloro-3-pyridinyl)-3-pyridinyl]oxy]thiane-3,4,5-triol (PubChem CID 87090565) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[[6-(2-chloro-3-pyridinyl)-3-pyridinyl]oxy]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[[6-(2-chloro-3-pyridinyl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 87090565 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (2R,3R,4S,5S)-2-[[6-(2-chloro-3-pyridinyl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2ccc(-c3cccnc3Cl)nc2)SC[C@H]1O |
| InChI | InChI=1S/C15H15ClN2O4S/c16-14-9(2-1-5-17-14)10-4-3-8(6-18-10)22-15-13(21)12(20)11(19)7-23-15/h1-6,11-13,15,19-21H,7H2/t11-,12+,13-,15-/m1/s1 |
| InChIKey | CBHMMTVRLNISGF-QVHKTLOISA-N |
| XLogP | 1.33 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|